C32H43N3O8 — CID 14137827
N-[[(1S,2S,10S,13S)-5,7,8,16,18,19-hexamethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaen-10-yl]methyl]-2-oxopropanamide (PubChem CID 14137827) has the molecular formula C32H43N3O8 and a molecular weight of 597.71 g/mol. Its IUPAC name is N-[[(1S,2S,10S,13S)-5,7,8,16,18,19-hexamethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaen-10-yl]methyl]-2-oxopropanamide.
| Compound Name | N-[[(1S,2S,10S,13S)-5,7,8,16,18,19-hexamethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaen-10-yl]methyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 14137827 |
| Molecular Formula | C32H43N3O8 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | N-[[(1S,2S,10S,13S)-5,7,8,16,18,19-hexamethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaen-10-yl]methyl]-2-oxopropanamide |
| SMILES | COc1c(C)c(OC)c(OC)c2c1C[C@H]1[C@@H]3c4c(c(OC)c(C)c(OC)c4OC)C[C@@H](CN1[C@@H]2CNC(=O)C(C)=O)N3C |
| InChI | InChI=1S/C32H43N3O8/c1-15-26(38-5)19-11-18-14-35-21(25(34(18)4)24(19)31(43-10)29(15)41-8)12-20-23(22(35)13-33-32(37)17(3)36)30(42-9)28(40-7)16(2)27(20)39-6/h18,21-22,25H,11-14H2,1-10H3,(H,33,37)/t18-,21-,22+,25+/m0/s1 |
| InChIKey | PLCPJIVULJOWET-QWUVBGQNSA-N |
| XLogP | 2.94 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|