About 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran
3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran (PubChem CID 141378568) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran |
| PubChem CID | 141378568 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran |
| SMILES | CC1(C2CC=COC2)CCOCC1 |
| InChI | InChI=1S/C11H18O2/c1-11(4-7-12-8-5-11)10-3-2-6-13-9-10/h2,6,10H,3-5,7-9H2,1H3 |
| InChIKey | QQLDLWRYLPBHQJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran?
The IUPAC name of 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran (CID 141378568) is 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran.
What is the SMILES notation for 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran?
The canonical SMILES for 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran is CC1(C2CC=COC2)CCOCC1.
What is the InChIKey of 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran?
The InChIKey is QQLDLWRYLPBHQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-11(4-7-12-8-5-11)10-3-2-6-13-9-10/h2,6,10H,3-5,7-9H2,1H3.
What are the key properties of 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran?
3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran has a molecular weight of 182.26 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyloxan-4-yl)-3,4-dihydro-2H-pyran is sourced from PubChem (CID 141378568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).