C16H30O2 — CID 158761039
(3R)-3,4-dimethyl-3,4-dihydro-2H-pyran;(3S,5R)-2,3,4,5-tetramethyloxane (PubChem CID 158761039) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (3R)-3,4-dimethyl-3,4-dihydro-2H-pyran;(3S,5R)-2,3,4,5-tetramethyloxane.
| Compound Name | (3R)-3,4-dimethyl-3,4-dihydro-2H-pyran;(3S,5R)-2,3,4,5-tetramethyloxane |
|---|---|
| PubChem CID | 158761039 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (3R)-3,4-dimethyl-3,4-dihydro-2H-pyran;(3S,5R)-2,3,4,5-tetramethyloxane |
| SMILES | CC1C=COC[C@@H]1C.CC1OC[C@H](C)C(C)[C@@H]1C |
| InChI | InChI=1S/C9H18O.C7H12O/c1-6-5-10-9(4)8(3)7(6)2;1-6-3-4-8-5-7(6)2/h6-9H,5H2,1-4H3;3-4,6-7H,5H2,1-2H3/t6-,7?,8-,9?;6?,7-/m00/s1 |
| InChIKey | IORBSTJVOWMFIT-LHQDRXTHSA-N |
| XLogP | 4.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |