C9H16O — CID 22082043
2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran (PubChem CID 22082043) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran.
| Compound Name | 2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 22082043 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 2-ethyl-3,4-dimethyl-3,4-dihydro-2H-pyran |
| SMILES | CCC1OC=CC(C)C1C |
| InChI | InChI=1S/C9H16O/c1-4-9-8(3)7(2)5-6-10-9/h5-9H,4H2,1-3H3 |
| InChIKey | PSAAZYPFGIMEMJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |