About 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole
5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole (PubChem CID 141381958) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole.
Analyze 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole?
The IUPAC name of 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole (CID 141381958) is 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole.
What is the SMILES notation for 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole?
The canonical SMILES for 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole is C=Cc1nc(N2CCCC2)nn1C.
What is the InChIKey of 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole?
The InChIKey is NMEPNGBZRIWGGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c1-3-8-10-9(11-12(8)2)13-6-4-5-7-13/h3H,1,4-7H2,2H3.
What are the key properties of 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole?
5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole has a molecular weight of 178.24 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-1-methyl-3-pyrrolidin-1-yl-1,2,4-triazole is sourced from PubChem (CID 141381958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).