C16H10F3N3O3 — CID 1413836
2-hydroxy-5-[[2-(trifluoromethyl)quinazolin-4-yl]amino]benzoic acid (PubChem CID 1413836) has the molecular formula C16H10F3N3O3 and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-hydroxy-5-[[2-(trifluoromethyl)quinazolin-4-yl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[2-(trifluoromethyl)quinazolin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 1413836 |
| Molecular Formula | C16H10F3N3O3 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-hydroxy-5-[[2-(trifluoromethyl)quinazolin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cc(Nc2nc(C(F)(F)F)nc3ccccc23)ccc1O |
| InChI | InChI=1S/C16H10F3N3O3/c17-16(18,19)15-21-11-4-2-1-3-9(11)13(22-15)20-8-5-6-12(23)10(7-8)14(24)25/h1-7,23H,(H,24,25)(H,20,21,22) |
| InChIKey | YHVYJUAGMQZLPH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|