C8H5F3IN3 — CID 141383836
5-iodo-3-methyl-2-(trifluoromethyl)imidazo[4,5-b]pyridine (PubChem CID 141383836) has the molecular formula C8H5F3IN3 and a molecular weight of 327.05 g/mol. Its IUPAC name is 5-iodo-3-methyl-2-(trifluoromethyl)imidazo[4,5-b]pyridine.
| Compound Name | 5-iodo-3-methyl-2-(trifluoromethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 141383836 |
| Molecular Formula | C8H5F3IN3 |
| Molecular Weight | 327.05 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 5-iodo-3-methyl-2-(trifluoromethyl)imidazo[4,5-b]pyridine |
| SMILES | Cn1c(C(F)(F)F)nc2ccc(I)nc21 |
| InChI | InChI=1S/C8H5F3IN3/c1-15-6-4(2-3-5(12)14-6)13-7(15)8(9,10)11/h2-3H,1H3 |
| InChIKey | GWSURXZOMDTSOH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.05 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|