C28H43NO2 — CID 141384102
1-(2,3,4,5-tetramethyl-7-octanoyl-1H-indol-6-yl)octan-1-one (PubChem CID 141384102) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is 1-(2,3,4,5-tetramethyl-7-octanoyl-1H-indol-6-yl)octan-1-one.
| Compound Name | 1-(2,3,4,5-tetramethyl-7-octanoyl-1H-indol-6-yl)octan-1-one |
|---|---|
| PubChem CID | 141384102 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | 1-(2,3,4,5-tetramethyl-7-octanoyl-1H-indol-6-yl)octan-1-one |
| SMILES | CCCCCCCC(=O)c1c(C)c(C)c2c(C)c(C)[nH]c2c1C(=O)CCCCCCC |
| InChI | InChI=1S/C28H43NO2/c1-7-9-11-13-15-17-23(30)26-20(4)19(3)25-21(5)22(6)29-28(25)27(26)24(31)18-16-14-12-10-8-2/h29H,7-18H2,1-6H3 |
| InChIKey | VXRTYZDTPYFCTF-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|