C31H30F3N5O — CID 141385665
4-ethenyl-1,2,3-trifluoro-5,6,6-trimethyl-3,4,5-tripyridin-2-yl-2-(pyridin-2-ylmethoxy)piperidine (PubChem CID 141385665) has the molecular formula C31H30F3N5O and a molecular weight of 545.61 g/mol. Its IUPAC name is 4-ethenyl-1,2,3-trifluoro-5,6,6-trimethyl-3,4,5-tripyridin-2-yl-2-(pyridin-2-ylmethoxy)piperidine.
| Compound Name | 4-ethenyl-1,2,3-trifluoro-5,6,6-trimethyl-3,4,5-tripyridin-2-yl-2-(pyridin-2-ylmethoxy)piperidine |
|---|---|
| PubChem CID | 141385665 |
| Molecular Formula | C31H30F3N5O |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 4-ethenyl-1,2,3-trifluoro-5,6,6-trimethyl-3,4,5-tripyridin-2-yl-2-(pyridin-2-ylmethoxy)piperidine |
| SMILES | C=CC1(c2ccccn2)C(C)(c2ccccn2)C(C)(C)N(F)C(F)(OCc2ccccn2)C1(F)c1ccccn1 |
| InChI | InChI=1S/C31H30F3N5O/c1-5-29(25-16-8-12-20-37-25)28(4,24-15-7-11-19-36-24)27(2,3)39(34)31(33,40-22-23-14-6-10-18-35-23)30(29,32)26-17-9-13-21-38-26/h5-21H,1,22H2,2-4H3 |
| InChIKey | BBGJBWRIAMWWAP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|