C11H16F3NO4 — CID 141386562
ethyl (2S)-4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoate (PubChem CID 141386562) has the molecular formula C11H16F3NO4 and a molecular weight of 283.25 g/mol. Its IUPAC name is ethyl (2S)-4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoate.
| Compound Name | ethyl (2S)-4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 141386562 |
| Molecular Formula | C11H16F3NO4 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl (2S)-4,4,4-trifluoro-3-methyl-2-(prop-2-enoxycarbonylamino)butanoate |
| SMILES | C=CCOC(=O)N[C@H](C(=O)OCC)C(C)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO4/c1-4-6-19-10(17)15-8(9(16)18-5-2)7(3)11(12,13)14/h4,7-8H,1,5-6H2,2-3H3,(H,15,17)/t7?,8-/m0/s1 |
| InChIKey | BBYODBHZMHWNPP-MQWKRIRWSA-N |
| XLogP | 2.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|