About 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride
2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride (PubChem CID 141390941) has the molecular formula C14H19ClN2O
and a molecular weight of 266.77 g/mol. Its IUPAC name is 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride.
Molecular Properties
| Compound Name | 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride |
| PubChem CID | 141390941 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccccc1)N1CC2(CCNCC2)C1 |
| InChI | InChI=1S/C14H18N2O.ClH/c17-13(12-4-2-1-3-5-12)16-10-14(11-16)6-8-15-9-7-14;/h1-5,15H,6-11H2;1H |
| InChIKey | QXFGWHNCMXMIJF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride?
The IUPAC name of 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride (CID 141390941) is 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride.
What is the SMILES notation for 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride?
The canonical SMILES for 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride is Cl.O=C(c1ccccc1)N1CC2(CCNCC2)C1.
What is the InChIKey of 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride?
The InChIKey is QXFGWHNCMXMIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O.ClH/c17-13(12-4-2-1-3-5-12)16-10-14(11-16)6-8-15-9-7-14;/h1-5,15H,6-11H2;1H.
What are the key properties of 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride?
2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride has a molecular weight of 266.77 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diazaspiro[3.5]nonan-2-yl(phenyl)methanone;hydrochloride is sourced from PubChem (CID 141390941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).