C15H18N4O — CID 166081618
2,7-diazaspiro[3.5]nonan-2-yl(1H-indazol-3-yl)methanone (PubChem CID 166081618) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 2,7-diazaspiro[3.5]nonan-2-yl(1H-indazol-3-yl)methanone.
| Compound Name | 2,7-diazaspiro[3.5]nonan-2-yl(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 166081618 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2,7-diazaspiro[3.5]nonan-2-yl(1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CC2(CCNCC2)C1 |
| InChI | InChI=1S/C15H18N4O/c20-14(13-11-3-1-2-4-12(11)17-18-13)19-9-15(10-19)5-7-16-8-6-15/h1-4,16H,5-10H2,(H,17,18) |
| InChIKey | WZKYEWGQTJRUBD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |