C10H5ClN2O — CID 141392235
8-chloro-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 141392235) has the molecular formula C10H5ClN2O and a molecular weight of 204.62 g/mol. Its IUPAC name is 8-chloro-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 8-chloro-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 141392235 |
| Molecular Formula | C10H5ClN2O |
| Molecular Weight | 204.62 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 8-chloro-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | Clc1ccc2oc3cncnc3c2c1 |
| InChI | InChI=1S/C10H5ClN2O/c11-6-1-2-8-7(3-6)10-9(14-8)4-12-5-13-10/h1-5H |
| InChIKey | LFHPKCGGSWLDMO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.62 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |