C13H5Cl2NOS — CID 167123653
2,9-dichloro-[1]benzofuro[3,2-e][1,3]benzothiazole (PubChem CID 167123653) has the molecular formula C13H5Cl2NOS and a molecular weight of 294.16 g/mol. Its IUPAC name is 2,9-dichloro-[1]benzofuro[3,2-e][1,3]benzothiazole.
| Compound Name | 2,9-dichloro-[1]benzofuro[3,2-e][1,3]benzothiazole |
|---|---|
| PubChem CID | 167123653 |
| Molecular Formula | C13H5Cl2NOS |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | 2,9-dichloro-[1]benzofuro[3,2-e][1,3]benzothiazole |
| SMILES | Clc1ccc2oc3ccc4sc(Cl)nc4c3c2c1 |
| InChI | InChI=1S/C13H5Cl2NOS/c14-6-1-2-8-7(5-6)11-9(17-8)3-4-10-12(11)16-13(15)18-10/h1-5H |
| InChIKey | YIWZQKXOYXMFOE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |