C16H8ClNO4 — CID 176647139
10-chloro-2-nitronaphtho[2,1-b][1]benzofuran-1-ol (PubChem CID 176647139) has the molecular formula C16H8ClNO4 and a molecular weight of 313.70 g/mol. Its IUPAC name is 10-chloro-2-nitronaphtho[2,1-b][1]benzofuran-1-ol.
| Compound Name | 10-chloro-2-nitronaphtho[2,1-b][1]benzofuran-1-ol |
|---|---|
| PubChem CID | 176647139 |
| Molecular Formula | C16H8ClNO4 |
| Molecular Weight | 313.70 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 10-chloro-2-nitronaphtho[2,1-b][1]benzofuran-1-ol |
| SMILES | O=[N+]([O-])c1ccc2ccc3oc4ccc(Cl)cc4c3c2c1O |
| InChI | InChI=1S/C16H8ClNO4/c17-9-3-6-12-10(7-9)15-13(22-12)5-2-8-1-4-11(18(20)21)16(19)14(8)15/h1-7,19H |
| InChIKey | NEKJUVOWAABRPD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|