C19H21ClN4S — CID 141392398
8-[(4-chlorophenyl)methyl]-11-(3-methylbutyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene (PubChem CID 141392398) has the molecular formula C19H21ClN4S and a molecular weight of 372.93 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)methyl]-11-(3-methylbutyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene.
| Compound Name | 8-[(4-chlorophenyl)methyl]-11-(3-methylbutyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene |
|---|---|
| PubChem CID | 141392398 |
| Molecular Formula | C19H21ClN4S |
| Molecular Weight | 372.93 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 8-[(4-chlorophenyl)methyl]-11-(3-methylbutyl)-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene |
| SMILES | CC(C)CCc1cc2c(s1)N(Cc1ccc(Cl)cc1)Cn1ncnc1-2 |
| InChI | InChI=1S/C19H21ClN4S/c1-13(2)3-8-16-9-17-18-21-11-22-24(18)12-23(19(17)25-16)10-14-4-6-15(20)7-5-14/h4-7,9,11,13H,3,8,10,12H2,1-2H3 |
| InChIKey | SIRDSORQGAIXCA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.93 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |