C16H32O4S2 — CID 141395063
2-ethyl-2-[1-[3-(2-ethylsulfanylethylsulfanyl)propoxy]propoxy]-4-methyl-1,3-dioxolane (PubChem CID 141395063) has the molecular formula C16H32O4S2 and a molecular weight of 352.56 g/mol. Its IUPAC name is 2-ethyl-2-[1-[3-(2-ethylsulfanylethylsulfanyl)propoxy]propoxy]-4-methyl-1,3-dioxolane.
| Compound Name | 2-ethyl-2-[1-[3-(2-ethylsulfanylethylsulfanyl)propoxy]propoxy]-4-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 141395063 |
| Molecular Formula | C16H32O4S2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-ethyl-2-[1-[3-(2-ethylsulfanylethylsulfanyl)propoxy]propoxy]-4-methyl-1,3-dioxolane |
| SMILES | CCSCCSCCCOC(CC)OC1(CC)OCC(C)O1 |
| InChI | InChI=1S/C16H32O4S2/c1-5-15(17-9-8-10-22-12-11-21-7-3)20-16(6-2)18-13-14(4)19-16/h14-15H,5-13H2,1-4H3 |
| InChIKey | VHCIJWJXTMXTCA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|