C7H13F2NO2 — CID 141395737
[(2R,5S)-5-(2,2-difluoroethyl)morpholin-2-yl]methanol (PubChem CID 141395737) has the molecular formula C7H13F2NO2 and a molecular weight of 181.18 g/mol. Its IUPAC name is [(2R,5S)-5-(2,2-difluoroethyl)morpholin-2-yl]methanol.
| Compound Name | [(2R,5S)-5-(2,2-difluoroethyl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 141395737 |
| Molecular Formula | C7H13F2NO2 |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | [(2R,5S)-5-(2,2-difluoroethyl)morpholin-2-yl]methanol |
| SMILES | OC[C@H]1CN[C@@H](CC(F)F)CO1 |
| InChI | InChI=1S/C7H13F2NO2/c8-7(9)1-5-4-12-6(3-11)2-10-5/h5-7,10-11H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | BALODOUWKXJLMT-NTSWFWBYSA-N |
| XLogP | -0.01 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |