C18H18Cl2N2O6 — CID 141397371
N-[[(6R,7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-4,7-dioxo-1,3-dioxepine-2-carboxamide (PubChem CID 141397371) has the molecular formula C18H18Cl2N2O6 and a molecular weight of 429.26 g/mol. Its IUPAC name is N-[[(6R,7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-4,7-dioxo-1,3-dioxepine-2-carboxamide.
| Compound Name | N-[[(6R,7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-4,7-dioxo-1,3-dioxepine-2-carboxamide |
|---|---|
| PubChem CID | 141397371 |
| Molecular Formula | C18H18Cl2N2O6 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | N-[[(6R,7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-4,7-dioxo-1,3-dioxepine-2-carboxamide |
| SMILES | O=C1C=CC(=O)OC(C(=O)NC[C@H]2CNCCO[C@@H]2c2ccc(Cl)c(Cl)c2)O1 |
| InChI | InChI=1S/C18H18Cl2N2O6/c19-12-2-1-10(7-13(12)20)16-11(8-21-5-6-26-16)9-22-17(25)18-27-14(23)3-4-15(24)28-18/h1-4,7,11,16,18,21H,5-6,8-9H2,(H,22,25)/t11-,16-/m1/s1 |
| InChIKey | YRZJLPRCEGCXTI-BDJLRTHQSA-N |
| XLogP | 1.37 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |