C20H20Cl2N6O2 — CID 123634243
N-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(2H-tetrazol-5-yl)benzamide (PubChem CID 123634243) has the molecular formula C20H20Cl2N6O2 and a molecular weight of 447.33 g/mol. Its IUPAC name is N-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(2H-tetrazol-5-yl)benzamide.
| Compound Name | N-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 123634243 |
| Molecular Formula | C20H20Cl2N6O2 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(2H-tetrazol-5-yl)benzamide |
| SMILES | O=C(NCC1CNCCOC1c1ccc(Cl)c(Cl)c1)c1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C20H20Cl2N6O2/c21-16-5-4-12(9-17(16)22)18-15(10-23-6-7-30-18)11-24-20(29)14-3-1-2-13(8-14)19-25-27-28-26-19/h1-5,8-9,15,18,23H,6-7,10-11H2,(H,24,29)(H,25,26,27,28) |
| InChIKey | NXSCVHSYKKBKLJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |