C22H21Cl2N3O4 — CID 159219870
N-[[(6S,7R)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(5-oxo-4H-1,2-oxazol-3-yl)benzamide (PubChem CID 159219870) has the molecular formula C22H21Cl2N3O4 and a molecular weight of 462.33 g/mol. Its IUPAC name is N-[[(6S,7R)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(5-oxo-4H-1,2-oxazol-3-yl)benzamide.
| Compound Name | N-[[(6S,7R)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(5-oxo-4H-1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 159219870 |
| Molecular Formula | C22H21Cl2N3O4 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | N-[[(6S,7R)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(5-oxo-4H-1,2-oxazol-3-yl)benzamide |
| SMILES | O=C1CC(c2cccc(C(=O)NC[C@@H]3CNCCO[C@H]3c3ccc(Cl)c(Cl)c3)c2)=NO1 |
| InChI | InChI=1S/C22H21Cl2N3O4/c23-17-5-4-14(9-18(17)24)21-16(11-25-6-7-30-21)12-26-22(29)15-3-1-2-13(8-15)19-10-20(28)31-27-19/h1-5,8-9,16,21,25H,6-7,10-12H2,(H,26,29)/t16-,21-/m0/s1 |
| InChIKey | KRNXPXAZLGNSEH-KKSFZXQISA-N |
| XLogP | 3.35 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|