C12H18O5 — CID 141398047
(2-hydroxy-3-prop-2-enoyloxyhexan-3-yl) prop-2-enoate (PubChem CID 141398047) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (2-hydroxy-3-prop-2-enoyloxyhexan-3-yl) prop-2-enoate.
| Compound Name | (2-hydroxy-3-prop-2-enoyloxyhexan-3-yl) prop-2-enoate |
|---|---|
| PubChem CID | 141398047 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2-hydroxy-3-prop-2-enoyloxyhexan-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC(CCC)(OC(=O)C=C)C(C)O |
| InChI | InChI=1S/C12H18O5/c1-5-8-12(9(4)13,16-10(14)6-2)17-11(15)7-3/h6-7,9,13H,2-3,5,8H2,1,4H3 |
| InChIKey | BPNSLARUGQOIRC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|