C19H25BrN2O3 — CID 141398313
propan-2-yl 3-(4-bromobutyl)-4-methyl-2-oxo-6-phenyl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 141398313) has the molecular formula C19H25BrN2O3 and a molecular weight of 409.32 g/mol. Its IUPAC name is propan-2-yl 3-(4-bromobutyl)-4-methyl-2-oxo-6-phenyl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-(4-bromobutyl)-4-methyl-2-oxo-6-phenyl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 141398313 |
| Molecular Formula | C19H25BrN2O3 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | propan-2-yl 3-(4-bromobutyl)-4-methyl-2-oxo-6-phenyl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccccc2)NC(=O)N1CCCCBr |
| InChI | InChI=1S/C19H25BrN2O3/c1-13(2)25-18(23)16-14(3)22(12-8-7-11-20)19(24)21-17(16)15-9-5-4-6-10-15/h4-6,9-10,13,17H,7-8,11-12H2,1-3H3,(H,21,24) |
| InChIKey | MJIOKUISYANWOK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|