C13H16O7 — CID 141398718
3-(4-hydroxy-2,3,5,6-tetramethoxyphenyl)prop-2-enoic acid (PubChem CID 141398718) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is 3-(4-hydroxy-2,3,5,6-tetramethoxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(4-hydroxy-2,3,5,6-tetramethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 141398718 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-(4-hydroxy-2,3,5,6-tetramethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1c(O)c(OC)c(OC)c(C=CC(=O)O)c1OC |
| InChI | InChI=1S/C13H16O7/c1-17-10-7(5-6-8(14)15)11(18-2)13(20-4)9(16)12(10)19-3/h5-6,16H,1-4H3,(H,14,15) |
| InChIKey | PCAIVPKIDRHWEE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|