About ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate
ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate (PubChem CID 141400249) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate.
Analyze ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate?
The IUPAC name of ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate (CID 141400249) is ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate is CCOC(=O)c1nccc2c1CNCN2.
What is the InChIKey of ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate?
The InChIKey is JRRHRVPRGSNHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c1-2-15-10(14)9-7-5-11-6-13-8(7)3-4-12-9/h3-4,11,13H,2,5-6H2,1H3.
What are the key properties of ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate?
ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate has a molecular weight of 207.23 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,2,3,4-tetrahydropyrido[4,3-d]pyrimidine-5-carboxylate is sourced from PubChem (CID 141400249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).