C21H32BrNO5 — CID 69296151
diethyl 4-(10-bromodecoxy)pyridine-2,3-dicarboxylate (PubChem CID 69296151) has the molecular formula C21H32BrNO5 and a molecular weight of 458.39 g/mol. Its IUPAC name is diethyl 4-(10-bromodecoxy)pyridine-2,3-dicarboxylate.
| Compound Name | diethyl 4-(10-bromodecoxy)pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 69296151 |
| Molecular Formula | C21H32BrNO5 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | diethyl 4-(10-bromodecoxy)pyridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1nccc(OCCCCCCCCCCBr)c1C(=O)OCC |
| InChI | InChI=1S/C21H32BrNO5/c1-3-26-20(24)18-17(13-15-23-19(18)21(25)27-4-2)28-16-12-10-8-6-5-7-9-11-14-22/h13,15H,3-12,14,16H2,1-2H3 |
| InChIKey | MCVRQJFOLDVMED-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|