C22H15N3O2 — CID 141401254
3-isoquinolin-1-yl-4-(7-methyl-1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 141401254) has the molecular formula C22H15N3O2 and a molecular weight of 353.38 g/mol. Its IUPAC name is 3-isoquinolin-1-yl-4-(7-methyl-1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-isoquinolin-1-yl-4-(7-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 141401254 |
| Molecular Formula | C22H15N3O2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-isoquinolin-1-yl-4-(7-methyl-1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | Cc1cccc2c(C3=C(c4nccc5ccccc45)C(=O)NC3=O)c[nH]c12 |
| InChI | InChI=1S/C22H15N3O2/c1-12-5-4-8-15-16(11-24-19(12)15)17-18(22(27)25-21(17)26)20-14-7-3-2-6-13(14)9-10-23-20/h2-11,24H,1H3,(H,25,26,27) |
| InChIKey | AIQZLECHBDCYJX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|