C16H30O5Si — CID 141401710
8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dioxaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 141401710) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is 8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dioxaspiro[4.4]nonane-8-carboxylic acid.
| Compound Name | 8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dioxaspiro[4.4]nonane-8-carboxylic acid |
|---|---|
| PubChem CID | 141401710 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,4-dioxaspiro[4.4]nonane-8-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1(C(=O)O)CCC2(C1)OCCO2 |
| InChI | InChI=1S/C16H30O5Si/c1-14(2,3)22(4,5)21-9-8-15(13(17)18)6-7-16(12-15)19-10-11-20-16/h6-12H2,1-5H3,(H,17,18) |
| InChIKey | HWWLCFOTGOAEFG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|