C18H34O6Si — CID 14486011
methyl 2-[(3aS,4S,5R,6R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2,5-trimethyl-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-yl]acetate (PubChem CID 14486011) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is methyl 2-[(3aS,4S,5R,6R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2,5-trimethyl-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-yl]acetate.
| Compound Name | methyl 2-[(3aS,4S,5R,6R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2,5-trimethyl-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-yl]acetate |
|---|---|
| PubChem CID | 14486011 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methyl 2-[(3aS,4S,5R,6R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2,5-trimethyl-3a,4,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-yl]acetate |
| SMILES | COC(=O)C[C@@]1(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C18H34O6Si/c1-16(2,3)25(8,9)24-15-13-12(22-17(4,5)23-13)14(20)18(15,6)10-11(19)21-7/h12-15,20H,10H2,1-9H3/t12-,13+,14+,15-,18-/m1/s1 |
| InChIKey | JKUHOSIBTVAZHC-SUKQMUEJSA-N |
| XLogP | 2.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|