C19H34O7Si — CID 11047708
ethyl 2-[(3aR,4S,5R,6S,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyloxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetate (PubChem CID 11047708) has the molecular formula C19H34O7Si and a molecular weight of 402.56 g/mol. Its IUPAC name is ethyl 2-[(3aR,4S,5R,6S,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyloxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetate.
| Compound Name | ethyl 2-[(3aR,4S,5R,6S,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyloxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 11047708 |
| Molecular Formula | C19H34O7Si |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | ethyl 2-[(3aR,4S,5R,6S,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyloxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](OC=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O7Si/c1-9-22-13(21)10-12-14-17(25-19(5,6)24-14)16(23-11-20)15(12)26-27(7,8)18(2,3)4/h11-12,14-17H,9-10H2,1-8H3/t12-,14+,15+,16+,17+/m0/s1 |
| InChIKey | JXXIAEPNUTYAEY-IIHMKKKESA-N |
| XLogP | 3.02 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|