C11H18O — CID 141402188
5-methyl-5-(propoxymethyl)cyclohexa-1,3-diene (PubChem CID 141402188) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 5-methyl-5-(propoxymethyl)cyclohexa-1,3-diene.
| Compound Name | 5-methyl-5-(propoxymethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141402188 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 5-methyl-5-(propoxymethyl)cyclohexa-1,3-diene |
| SMILES | CCCOCC1(C)C=CC=CC1 |
| InChI | InChI=1S/C11H18O/c1-3-9-12-10-11(2)7-5-4-6-8-11/h4-7H,3,8-10H2,1-2H3 |
| InChIKey | BZBHQWRQOBDWNK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|