C24H32N2O — CID 141403014
N-[4-(diethylamino)-2-methyl-2,4-diphenylbutyl]prop-2-enamide (PubChem CID 141403014) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methyl-2,4-diphenylbutyl]prop-2-enamide.
| Compound Name | N-[4-(diethylamino)-2-methyl-2,4-diphenylbutyl]prop-2-enamide |
|---|---|
| PubChem CID | 141403014 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N-[4-(diethylamino)-2-methyl-2,4-diphenylbutyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(C)(CC(c1ccccc1)N(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O/c1-5-23(27)25-19-24(4,21-16-12-9-13-17-21)18-22(26(6-2)7-3)20-14-10-8-11-15-20/h5,8-17,22H,1,6-7,18-19H2,2-4H3,(H,25,27) |
| InChIKey | TZGSAKCRLYCOFO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|