C24H23FN4 — CID 141403251
2-(6-fluoro-2-pyridinyl)-8-[1-(6-methylindazol-1-yl)ethyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 141403251) has the molecular formula C24H23FN4 and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(6-fluoro-2-pyridinyl)-8-[1-(6-methylindazol-1-yl)ethyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(6-fluoro-2-pyridinyl)-8-[1-(6-methylindazol-1-yl)ethyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 141403251 |
| Molecular Formula | C24H23FN4 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-(6-fluoro-2-pyridinyl)-8-[1-(6-methylindazol-1-yl)ethyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1ccc2cnn(C(C)c3cccc4c3CN(c3cccc(F)n3)CC4)c2c1 |
| InChI | InChI=1S/C24H23FN4/c1-16-9-10-19-14-26-29(22(19)13-16)17(2)20-6-3-5-18-11-12-28(15-21(18)20)24-8-4-7-23(25)27-24/h3-10,13-14,17H,11-12,15H2,1-2H3 |
| InChIKey | KIHUSQRCFAWSSB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|