C16H18FN3 — CID 141404835
1-[(4-fluorophenyl)methyl]-3,5-bis(prop-2-ynyl)-1,3,5-triazinane (PubChem CID 141404835) has the molecular formula C16H18FN3 and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3,5-bis(prop-2-ynyl)-1,3,5-triazinane.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3,5-bis(prop-2-ynyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 141404835 |
| Molecular Formula | C16H18FN3 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3,5-bis(prop-2-ynyl)-1,3,5-triazinane |
| SMILES | C#CCN1CN(CC#C)CN(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H18FN3/c1-3-9-18-12-19(10-4-2)14-20(13-18)11-15-5-7-16(17)8-6-15/h1-2,5-8H,9-14H2 |
| InChIKey | KAZNEIHVYQZEGF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|