C20H20O2S — CID 141405012
5-(4-pentanoylphenyl)sulfanyl-2,3-dihydroinden-1-one (PubChem CID 141405012) has the molecular formula C20H20O2S and a molecular weight of 324.44 g/mol. Its IUPAC name is 5-(4-pentanoylphenyl)sulfanyl-2,3-dihydroinden-1-one.
| Compound Name | 5-(4-pentanoylphenyl)sulfanyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 141405012 |
| Molecular Formula | C20H20O2S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 5-(4-pentanoylphenyl)sulfanyl-2,3-dihydroinden-1-one |
| SMILES | CCCCC(=O)c1ccc(Sc2ccc3c(c2)CCC3=O)cc1 |
| InChI | InChI=1S/C20H20O2S/c1-2-3-4-19(21)14-5-8-16(9-6-14)23-17-10-11-18-15(13-17)7-12-20(18)22/h5-6,8-11,13H,2-4,7,12H2,1H3 |
| InChIKey | INNNCNSMZVGJSL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |