C23H21N3O5 — CID 141405428
N-(3-methoxyphenyl)-2-[2-(4-nitrophenyl)-2,4-dihydro-3,1-benzoxazin-1-yl]acetamide (PubChem CID 141405428) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[2-(4-nitrophenyl)-2,4-dihydro-3,1-benzoxazin-1-yl]acetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[2-(4-nitrophenyl)-2,4-dihydro-3,1-benzoxazin-1-yl]acetamide |
|---|---|
| PubChem CID | 141405428 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[2-(4-nitrophenyl)-2,4-dihydro-3,1-benzoxazin-1-yl]acetamide |
| SMILES | COc1cccc(NC(=O)CN2c3ccccc3COC2c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C23H21N3O5/c1-30-20-7-4-6-18(13-20)24-22(27)14-25-21-8-3-2-5-17(21)15-31-23(25)16-9-11-19(12-10-16)26(28)29/h2-13,23H,14-15H2,1H3,(H,24,27) |
| InChIKey | DGGCPLSUBYAPGM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|