C23H23N3O3 — CID 174784172
1-(3-methylphenyl)-2-[2-(3-nitrophenyl)-2,4-dihydro-3,1-benzoxazin-1-yl]ethanamine (PubChem CID 174784172) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-[2-(3-nitrophenyl)-2,4-dihydro-3,1-benzoxazin-1-yl]ethanamine.
| Compound Name | 1-(3-methylphenyl)-2-[2-(3-nitrophenyl)-2,4-dihydro-3,1-benzoxazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 174784172 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-(3-methylphenyl)-2-[2-(3-nitrophenyl)-2,4-dihydro-3,1-benzoxazin-1-yl]ethanamine |
| SMILES | Cc1cccc(C(N)CN2c3ccccc3COC2c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H23N3O3/c1-16-6-4-8-17(12-16)21(24)14-25-22-11-3-2-7-19(22)15-29-23(25)18-9-5-10-20(13-18)26(27)28/h2-13,21,23H,14-15,24H2,1H3 |
| InChIKey | NXHLEKWPLMFVQC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|