C23H20N2O4 — CID 163869671
1-(2-methylphenyl)-2-[2-(3-nitrophenyl)-2,4-dihydro-1,3-benzoxazin-3-yl]ethanone (PubChem CID 163869671) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1-(2-methylphenyl)-2-[2-(3-nitrophenyl)-2,4-dihydro-1,3-benzoxazin-3-yl]ethanone.
| Compound Name | 1-(2-methylphenyl)-2-[2-(3-nitrophenyl)-2,4-dihydro-1,3-benzoxazin-3-yl]ethanone |
|---|---|
| PubChem CID | 163869671 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-(2-methylphenyl)-2-[2-(3-nitrophenyl)-2,4-dihydro-1,3-benzoxazin-3-yl]ethanone |
| SMILES | Cc1ccccc1C(=O)CN1Cc2ccccc2OC1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N2O4/c1-16-7-2-4-11-20(16)21(26)15-24-14-18-8-3-5-12-22(18)29-23(24)17-9-6-10-19(13-17)25(27)28/h2-13,23H,14-15H2,1H3 |
| InChIKey | PJRKSNGTSNNIBE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|