C27H23N3O7 — CID 23848160
ethyl 2-[2-(2-methylphenyl)-3-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate (PubChem CID 23848160) has the molecular formula C27H23N3O7 and a molecular weight of 501.50 g/mol. Its IUPAC name is ethyl 2-[2-(2-methylphenyl)-3-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate.
| Compound Name | ethyl 2-[2-(2-methylphenyl)-3-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 23848160 |
| Molecular Formula | C27H23N3O7 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | ethyl 2-[2-(2-methylphenyl)-3-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1N1C(=O)C2ON(c3ccccc3C)C(c3cccc([N+](=O)[O-])c3)C2C1=O |
| InChI | InChI=1S/C27H23N3O7/c1-3-36-27(33)19-12-5-7-14-21(19)28-25(31)22-23(17-10-8-11-18(15-17)30(34)35)29(37-24(22)26(28)32)20-13-6-4-9-16(20)2/h4-15,22-24H,3H2,1-2H3 |
| InChIKey | YANMUVULKHMBBP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|