C17H18ClF3N2O — CID 141409304
1-[[5-chloro-2-[[1-(trifluoromethyl)cyclobutyl]methoxy]phenyl]methyl]-5-methylpyrazole (PubChem CID 141409304) has the molecular formula C17H18ClF3N2O and a molecular weight of 358.79 g/mol. Its IUPAC name is 1-[[5-chloro-2-[[1-(trifluoromethyl)cyclobutyl]methoxy]phenyl]methyl]-5-methylpyrazole.
| Compound Name | 1-[[5-chloro-2-[[1-(trifluoromethyl)cyclobutyl]methoxy]phenyl]methyl]-5-methylpyrazole |
|---|---|
| PubChem CID | 141409304 |
| Molecular Formula | C17H18ClF3N2O |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[[5-chloro-2-[[1-(trifluoromethyl)cyclobutyl]methoxy]phenyl]methyl]-5-methylpyrazole |
| SMILES | Cc1ccnn1Cc1cc(Cl)ccc1OCC1(C(F)(F)F)CCC1 |
| InChI | InChI=1S/C17H18ClF3N2O/c1-12-5-8-22-23(12)10-13-9-14(18)3-4-15(13)24-11-16(6-2-7-16)17(19,20)21/h3-5,8-9H,2,6-7,10-11H2,1H3 |
| InChIKey | RRRVVWDWNIATHZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |