2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid

C7H12O4 — CID 14141014

IUPAC2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid
SMILESCC1(C)OCC(CC(=O)O)O1
InChIInChI=1S/C7H12O4/c1-7(2)10-4-5(11-7)3-6(8)9/h5H,3-4H2,1-2H3,(H,8,9)
InChIKeyOIUZBDNWEHNDHO-UHFFFAOYSA-N
MW160.17 g/mol
LogP0.61
Rot. Bonds2

About 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid

2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid (PubChem CID 14141014) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid.

Molecular Properties

Compound Name2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid
PubChem CID14141014
Molecular FormulaC7H12O4
Molecular Weight160.17 g/mol
Exact Mass160.07
IUPAC Name2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid
SMILESCC1(C)OCC(CC(=O)O)O1
InChIInChI=1S/C7H12O4/c1-7(2)10-4-5(11-7)3-6(8)9/h5H,3-4H2,1-2H3,(H,8,9)
InChIKeyOIUZBDNWEHNDHO-UHFFFAOYSA-N
XLogP0.61
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid?
The IUPAC name of 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid (CID 14141014) is 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid.
What is the SMILES notation for 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid?
The canonical SMILES for 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid is CC1(C)OCC(CC(=O)O)O1.
What is the InChIKey of 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid?
The InChIKey is OIUZBDNWEHNDHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-7(2)10-4-5(11-7)3-6(8)9/h5H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid?
2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid has a molecular weight of 160.17 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetic acid is sourced from PubChem (CID 14141014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).