C14H15N2O5P — CID 141410498
[2-(4-nitroanilino)-2-phenylethyl]phosphonic acid (PubChem CID 141410498) has the molecular formula C14H15N2O5P and a molecular weight of 322.26 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-phenylethyl]phosphonic acid.
| Compound Name | [2-(4-nitroanilino)-2-phenylethyl]phosphonic acid |
|---|---|
| PubChem CID | 141410498 |
| Molecular Formula | C14H15N2O5P |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [2-(4-nitroanilino)-2-phenylethyl]phosphonic acid |
| SMILES | O=[N+]([O-])c1ccc(NC(CP(=O)(O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N2O5P/c17-16(18)13-8-6-12(7-9-13)15-14(10-22(19,20)21)11-4-2-1-3-5-11/h1-9,14-15H,10H2,(H2,19,20,21) |
| InChIKey | PFPLUDYCJUFAOZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|