C22H23N — CID 141411343
4-methyl-N,N-diphenyl-3-propylaniline (PubChem CID 141411343) has the molecular formula C22H23N and a molecular weight of 301.43 g/mol. Its IUPAC name is 4-methyl-N,N-diphenyl-3-propylaniline.
| Compound Name | 4-methyl-N,N-diphenyl-3-propylaniline |
|---|---|
| PubChem CID | 141411343 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 4-methyl-N,N-diphenyl-3-propylaniline |
| SMILES | CCCc1cc(N(c2ccccc2)c2ccccc2)ccc1C |
| InChI | InChI=1S/C22H23N/c1-3-10-19-17-22(16-15-18(19)2)23(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-9,11-17H,3,10H2,1-2H3 |
| InChIKey | KTGRGPQWSJAWOM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |