C25H35N5 — CID 141411699
4-[3-ethyl-4-(4-phenylpyrimidin-2-yl)piperazin-1-yl]-4-methyl-1-azabicyclo[3.2.2]nonane (PubChem CID 141411699) has the molecular formula C25H35N5 and a molecular weight of 405.59 g/mol. Its IUPAC name is 4-[3-ethyl-4-(4-phenylpyrimidin-2-yl)piperazin-1-yl]-4-methyl-1-azabicyclo[3.2.2]nonane.
| Compound Name | 4-[3-ethyl-4-(4-phenylpyrimidin-2-yl)piperazin-1-yl]-4-methyl-1-azabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 141411699 |
| Molecular Formula | C25H35N5 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 4-[3-ethyl-4-(4-phenylpyrimidin-2-yl)piperazin-1-yl]-4-methyl-1-azabicyclo[3.2.2]nonane |
| SMILES | CCC1CN(C2(C)CCN3CCC2CC3)CCN1c1nccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H35N5/c1-3-22-19-29(25(2)12-16-28-14-10-21(25)11-15-28)17-18-30(22)24-26-13-9-23(27-24)20-7-5-4-6-8-20/h4-9,13,21-22H,3,10-12,14-19H2,1-2H3 |
| InChIKey | XSRJRCIEKAYDLZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |