C20H33NO2 — CID 141412105
1-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 141412105) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | 1-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 141412105 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 1-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CC12CCC3C(CCC4CCCC(O)C43C)C1CCC2C(N)=O |
| InChI | InChI=1S/C20H33NO2/c1-19-11-10-15-13(14(19)8-9-16(19)18(21)23)7-6-12-4-3-5-17(22)20(12,15)2/h12-17,22H,3-11H2,1-2H3,(H2,21,23) |
| InChIKey | ROKIGYFFUZGVNR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |