C21H17ClN4O5S — CID 141412273
2-[[5-(3-chlorophenyl)-4-[(2,3-dihydroxyphenyl)methylamino]-1,2,4-triazol-3-yl]sulfanylmethyl]-5-hydroxypyran-4-one (PubChem CID 141412273) has the molecular formula C21H17ClN4O5S and a molecular weight of 472.91 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-4-[(2,3-dihydroxyphenyl)methylamino]-1,2,4-triazol-3-yl]sulfanylmethyl]-5-hydroxypyran-4-one.
| Compound Name | 2-[[5-(3-chlorophenyl)-4-[(2,3-dihydroxyphenyl)methylamino]-1,2,4-triazol-3-yl]sulfanylmethyl]-5-hydroxypyran-4-one |
|---|---|
| PubChem CID | 141412273 |
| Molecular Formula | C21H17ClN4O5S |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-4-[(2,3-dihydroxyphenyl)methylamino]-1,2,4-triazol-3-yl]sulfanylmethyl]-5-hydroxypyran-4-one |
| SMILES | O=c1cc(CSc2nnc(-c3cccc(Cl)c3)n2NCc2cccc(O)c2O)occ1O |
| InChI | InChI=1S/C21H17ClN4O5S/c22-14-5-1-3-12(7-14)20-24-25-21(32-11-15-8-17(28)18(29)10-31-15)26(20)23-9-13-4-2-6-16(27)19(13)30/h1-8,10,23,27,29-30H,9,11H2 |
| InChIKey | VELSSCBSRJUABV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 133.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|