C18H19NO7S — CID 141412342
2-[(3R)-4-ethoxy-3-(4-nitrophenyl)-4-oxobutyl]benzenesulfonic acid (PubChem CID 141412342) has the molecular formula C18H19NO7S and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-[(3R)-4-ethoxy-3-(4-nitrophenyl)-4-oxobutyl]benzenesulfonic acid.
| Compound Name | 2-[(3R)-4-ethoxy-3-(4-nitrophenyl)-4-oxobutyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 141412342 |
| Molecular Formula | C18H19NO7S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[(3R)-4-ethoxy-3-(4-nitrophenyl)-4-oxobutyl]benzenesulfonic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1S(=O)(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19NO7S/c1-2-26-18(20)16(13-7-10-15(11-8-13)19(21)22)12-9-14-5-3-4-6-17(14)27(23,24)25/h3-8,10-11,16H,2,9,12H2,1H3,(H,23,24,25)/t16-/m1/s1 |
| InChIKey | ZRVDLECNIYSWPI-MRXNPFEDSA-N |
| XLogP | 3.12 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|