C15H11ClN4 — CID 141413145
2-(2-chloro-4-pyridinyl)-5-cyclopropylpyrido[3,4-d]pyrimidine (PubChem CID 141413145) has the molecular formula C15H11ClN4 and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-(2-chloro-4-pyridinyl)-5-cyclopropylpyrido[3,4-d]pyrimidine.
| Compound Name | 2-(2-chloro-4-pyridinyl)-5-cyclopropylpyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 141413145 |
| Molecular Formula | C15H11ClN4 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-(2-chloro-4-pyridinyl)-5-cyclopropylpyrido[3,4-d]pyrimidine |
| SMILES | Clc1cc(-c2ncc3c(C4CC4)cncc3n2)ccn1 |
| InChI | InChI=1S/C15H11ClN4/c16-14-5-10(3-4-18-14)15-19-7-12-11(9-1-2-9)6-17-8-13(12)20-15/h3-9H,1-2H2 |
| InChIKey | TWCCEZFWOYOUPR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|