C17H18ClN5O2 — CID 141413175
tert-butyl N-(2-chloropyrimidin-4-yl)-N-(6-methyl-1H-indazol-5-yl)carbamate (PubChem CID 141413175) has the molecular formula C17H18ClN5O2 and a molecular weight of 359.82 g/mol. Its IUPAC name is tert-butyl N-(2-chloropyrimidin-4-yl)-N-(6-methyl-1H-indazol-5-yl)carbamate.
| Compound Name | tert-butyl N-(2-chloropyrimidin-4-yl)-N-(6-methyl-1H-indazol-5-yl)carbamate |
|---|---|
| PubChem CID | 141413175 |
| Molecular Formula | C17H18ClN5O2 |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | tert-butyl N-(2-chloropyrimidin-4-yl)-N-(6-methyl-1H-indazol-5-yl)carbamate |
| SMILES | Cc1cc2[nH]ncc2cc1N(C(=O)OC(C)(C)C)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C17H18ClN5O2/c1-10-7-12-11(9-20-22-12)8-13(10)23(16(24)25-17(2,3)4)14-5-6-19-15(18)21-14/h5-9H,1-4H3,(H,20,22) |
| InChIKey | WLCMNJKBLRKZFF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |