C12H15ClN4O2 — CID 167297723
tert-butyl N-(2-chloropyrimidin-4-yl)-N-(3-iminoprop-1-en-2-yl)carbamate (PubChem CID 167297723) has the molecular formula C12H15ClN4O2 and a molecular weight of 282.73 g/mol. Its IUPAC name is tert-butyl N-(2-chloropyrimidin-4-yl)-N-(3-iminoprop-1-en-2-yl)carbamate.
| Compound Name | tert-butyl N-(2-chloropyrimidin-4-yl)-N-(3-iminoprop-1-en-2-yl)carbamate |
|---|---|
| PubChem CID | 167297723 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | tert-butyl N-(2-chloropyrimidin-4-yl)-N-(3-iminoprop-1-en-2-yl)carbamate |
| SMILES | [H]/N=C/C(=C)N(C(=O)OC(C)(C)C)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C12H15ClN4O2/c1-8(7-14)17(11(18)19-12(2,3)4)9-5-6-15-10(13)16-9/h5-7,14H,1H2,2-4H3/b14-7+ |
| InChIKey | DLDFQKBUBLZWMR-VGOFMYFVSA-N |
| XLogP | 3.03 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|